C18H18ClNO5S — CID 123098657
4-[3-[2-(4-chloroanilino)-2-oxoethyl]sulfinylpropoxy]benzoic acid (PubChem CID 123098657) has the molecular formula C18H18ClNO5S and a molecular weight of 395.86 g/mol. Its IUPAC name is 4-[3-[2-(4-chloroanilino)-2-oxoethyl]sulfinylpropoxy]benzoic acid.
| Compound Name | 4-[3-[2-(4-chloroanilino)-2-oxoethyl]sulfinylpropoxy]benzoic acid |
|---|---|
| PubChem CID | 123098657 |
| Molecular Formula | C18H18ClNO5S |
| Molecular Weight | 395.86 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 4-[3-[2-(4-chloroanilino)-2-oxoethyl]sulfinylpropoxy]benzoic acid |
| SMILES | O=C(CS(=O)CCCOc1ccc(C(=O)O)cc1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18ClNO5S/c19-14-4-6-15(7-5-14)20-17(21)12-26(24)11-1-10-25-16-8-2-13(3-9-16)18(22)23/h2-9H,1,10-12H2,(H,20,21)(H,22,23) |
| InChIKey | CWFXBLMLPUOFNA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.86 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|