C7H17NOS — CID 123113037
N,N-diethyl-2-methylsulfinylethanamine (PubChem CID 123113037) has the molecular formula C7H17NOS and a molecular weight of 163.29 g/mol. Its IUPAC name is N,N-diethyl-2-methylsulfinylethanamine.
| Compound Name | N,N-diethyl-2-methylsulfinylethanamine |
|---|---|
| PubChem CID | 123113037 |
| Molecular Formula | C7H17NOS |
| Molecular Weight | 163.29 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | N,N-diethyl-2-methylsulfinylethanamine |
| SMILES | CCN(CC)CCS(C)=O |
| InChI | InChI=1S/C7H17NOS/c1-4-8(5-2)6-7-10(3)9/h4-7H2,1-3H3 |
| InChIKey | OOSNFXPYMUBEEL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |