C23H18FNO4S — CID 1231154
(5Z)-5-[(2,7-dimethoxynaphthalen-1-yl)methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 1231154) has the molecular formula C23H18FNO4S and a molecular weight of 423.47 g/mol. Its IUPAC name is (5Z)-5-[(2,7-dimethoxynaphthalen-1-yl)methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(2,7-dimethoxynaphthalen-1-yl)methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 1231154 |
| Molecular Formula | C23H18FNO4S |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | (5Z)-5-[(2,7-dimethoxynaphthalen-1-yl)methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc2ccc(OC)c(/C=C3\SC(=O)N(Cc4ccc(F)cc4)C3=O)c2c1 |
| InChI | InChI=1S/C23H18FNO4S/c1-28-17-9-5-15-6-10-20(29-2)19(18(15)11-17)12-21-22(26)25(23(27)30-21)13-14-3-7-16(24)8-4-14/h3-12H,13H2,1-2H3/b21-12- |
| InChIKey | GYHVBIMSUBGHQY-MTJSOVHGSA-N |
| XLogP | 5.23 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|