About 3-methylideneindole
3-methylideneindole (PubChem CID 123131584) has the molecular formula C9H6N+
and a molecular weight of 128.15 g/mol. Its IUPAC name is 3-methylideneindole.
Molecular Properties
| Compound Name | 3-methylideneindole |
| PubChem CID | 123131584 |
| Molecular Formula | C9H6N+ |
| Molecular Weight | 128.15 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | 3-methylideneindole |
| SMILES | [H]/[C+]=C1\C=Nc2ccccc21 |
| InChI | InChI=1S/C9H6N/c1-7-6-10-9-5-3-2-4-8(7)9/h1-6H/q+1 |
| InChIKey | NSQIQDGIPQVASR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.15 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-methylideneindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylideneindole?
The IUPAC name of 3-methylideneindole (CID 123131584) is 3-methylideneindole.
What is the SMILES notation for 3-methylideneindole?
The canonical SMILES for 3-methylideneindole is [H]/[C+]=C1\C=Nc2ccccc21.
What is the InChIKey of 3-methylideneindole?
The InChIKey is NSQIQDGIPQVASR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N/c1-7-6-10-9-5-3-2-4-8(7)9/h1-6H/q+1.
What are the key properties of 3-methylideneindole?
3-methylideneindole has a molecular weight of 128.15 g/mol, XLogP of 2.22, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylideneindole is sourced from PubChem (CID 123131584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).