C33H40ClN3O6 — CID 123131664
cyclohexyl 4-[4-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]butylamino]-4-oxobutanoate (PubChem CID 123131664) has the molecular formula C33H40ClN3O6 and a molecular weight of 610.15 g/mol. Its IUPAC name is cyclohexyl 4-[4-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]butylamino]-4-oxobutanoate.
| Compound Name | cyclohexyl 4-[4-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]butylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 123131664 |
| Molecular Formula | C33H40ClN3O6 |
| Molecular Weight | 610.15 g/mol |
| Exact Mass | 609.26 |
| IUPAC Name | cyclohexyl 4-[4-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]butylamino]-4-oxobutanoate |
| SMILES | COc1ccc2c(c1)c(CC(=O)NCCCCNC(=O)CCC(=O)OC1CCCCC1)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C33H40ClN3O6/c1-22-27(28-20-26(42-2)14-15-29(28)37(22)33(41)23-10-12-24(34)13-11-23)21-31(39)36-19-7-6-18-35-30(38)16-17-32(40)43-25-8-4-3-5-9-25/h10-15,20,25H,3-9,16-19,21H2,1-2H3,(H,35,38)(H,36,39) |
| InChIKey | QPMWEMKOGLMYSL-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.15 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|