C21H24F4N6O2 — CID 123131695
6-[[4-fluoro-3-[5-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]phenyl]methyl]-4,5-dimethyldiazinan-3-one (PubChem CID 123131695) has the molecular formula C21H24F4N6O2 and a molecular weight of 468.46 g/mol. Its IUPAC name is 6-[[4-fluoro-3-[5-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]phenyl]methyl]-4,5-dimethyldiazinan-3-one.
| Compound Name | 6-[[4-fluoro-3-[5-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]phenyl]methyl]-4,5-dimethyldiazinan-3-one |
|---|---|
| PubChem CID | 123131695 |
| Molecular Formula | C21H24F4N6O2 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 6-[[4-fluoro-3-[5-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]phenyl]methyl]-4,5-dimethyldiazinan-3-one |
| SMILES | CC1C(=O)NNC(Cc2ccc(F)c(C(=O)N3Cc4nnc(C(F)(F)F)n4C(C)C3)c2)C1C |
| InChI | InChI=1S/C21H24F4N6O2/c1-10-8-30(9-17-27-29-20(31(10)17)21(23,24)25)19(33)14-6-13(4-5-15(14)22)7-16-11(2)12(3)18(32)28-26-16/h4-6,10-12,16,26H,7-9H2,1-3H3,(H,28,32) |
| InChIKey | IJILWUUFIFUAHG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |