C26H24N4O5 — CID 123131721
1-N-[(1S)-2-(4-ethoxyanilino)-1-(1H-indol-3-yl)-2-oxoethyl]-4-N-hydroxybenzene-1,4-dicarboxamide (PubChem CID 123131721) has the molecular formula C26H24N4O5 and a molecular weight of 472.50 g/mol. Its IUPAC name is 1-N-[(1S)-2-(4-ethoxyanilino)-1-(1H-indol-3-yl)-2-oxoethyl]-4-N-hydroxybenzene-1,4-dicarboxamide.
| Compound Name | 1-N-[(1S)-2-(4-ethoxyanilino)-1-(1H-indol-3-yl)-2-oxoethyl]-4-N-hydroxybenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 123131721 |
| Molecular Formula | C26H24N4O5 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 1-N-[(1S)-2-(4-ethoxyanilino)-1-(1H-indol-3-yl)-2-oxoethyl]-4-N-hydroxybenzene-1,4-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H](NC(=O)c2ccc(C(=O)NO)cc2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C26H24N4O5/c1-2-35-19-13-11-18(12-14-19)28-26(33)23(21-15-27-22-6-4-3-5-20(21)22)29-24(31)16-7-9-17(10-8-16)25(32)30-34/h3-15,23,27,34H,2H2,1H3,(H,28,33)(H,29,31)(H,30,32)/t23-/m0/s1 |
| InChIKey | TWXUKOFEUQOKJU-QHCPKHFHSA-N |
| XLogP | 3.80 |
| TPSA | 132.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|