About 4-methyl-1,7-dihydropurin-6-amine
4-methyl-1,7-dihydropurin-6-amine (PubChem CID 123132015) has the molecular formula C6H9N5
and a molecular weight of 151.17 g/mol. Its IUPAC name is 4-methyl-1,7-dihydropurin-6-amine.
Molecular Properties
| Compound Name | 4-methyl-1,7-dihydropurin-6-amine |
| PubChem CID | 123132015 |
| Molecular Formula | C6H9N5 |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.09 |
| IUPAC Name | 4-methyl-1,7-dihydropurin-6-amine |
| SMILES | CC12N=CNC(N)=C1NC=N2 |
| InChI | InChI=1S/C6H9N5/c1-6-4(8-2-10-6)5(7)9-3-11-6/h2-3H,7H2,1H3,(H,8,10)(H,9,11) |
| InChIKey | JNOYFTMTEHAEMU-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 74.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methyl-1,7-dihydropurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,7-dihydropurin-6-amine?
The IUPAC name of 4-methyl-1,7-dihydropurin-6-amine (CID 123132015) is 4-methyl-1,7-dihydropurin-6-amine.
What is the SMILES notation for 4-methyl-1,7-dihydropurin-6-amine?
The canonical SMILES for 4-methyl-1,7-dihydropurin-6-amine is CC12N=CNC(N)=C1NC=N2.
What is the InChIKey of 4-methyl-1,7-dihydropurin-6-amine?
The InChIKey is JNOYFTMTEHAEMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N5/c1-6-4(8-2-10-6)5(7)9-3-11-6/h2-3H,7H2,1H3,(H,8,10)(H,9,11).
What are the key properties of 4-methyl-1,7-dihydropurin-6-amine?
4-methyl-1,7-dihydropurin-6-amine has a molecular weight of 151.17 g/mol, XLogP of -0.91, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,7-dihydropurin-6-amine is sourced from PubChem (CID 123132015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).