C16H24O7P2S — CID 123132253
[(2E,6E)-3,7-dimethyl-8-phenylsulfanylocta-2,6-dienyl] phosphono hydrogen phosphate (PubChem CID 123132253) has the molecular formula C16H24O7P2S and a molecular weight of 422.38 g/mol. Its IUPAC name is [(2E,6E)-3,7-dimethyl-8-phenylsulfanylocta-2,6-dienyl] phosphono hydrogen phosphate.
| Compound Name | [(2E,6E)-3,7-dimethyl-8-phenylsulfanylocta-2,6-dienyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 123132253 |
| Molecular Formula | C16H24O7P2S |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | [(2E,6E)-3,7-dimethyl-8-phenylsulfanylocta-2,6-dienyl] phosphono hydrogen phosphate |
| SMILES | C/C(=C\COP(=O)(O)OP(=O)(O)O)CC/C=C(\C)CSc1ccccc1 |
| InChI | InChI=1S/C16H24O7P2S/c1-14(11-12-22-25(20,21)23-24(17,18)19)7-6-8-15(2)13-26-16-9-4-3-5-10-16/h3-5,8-11H,6-7,12-13H2,1-2H3,(H,20,21)(H2,17,18,19)/b14-11+,15-8+ |
| InChIKey | IBODFWQGOKTNEE-GGQZXFEVSA-N |
| XLogP | 4.68 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|