C17H21F3NO7P2-3 — CID 123132263
[[(2E,6E)-3,7-dimethyl-8-[3-(trifluoromethyl)anilino]octa-2,6-dienoxy]-oxidophosphoryl] phosphate (PubChem CID 123132263) has the molecular formula C17H21F3NO7P2-3 and a molecular weight of 470.30 g/mol. Its IUPAC name is [[(2E,6E)-3,7-dimethyl-8-[3-(trifluoromethyl)anilino]octa-2,6-dienoxy]-oxidophosphoryl] phosphate.
| Compound Name | [[(2E,6E)-3,7-dimethyl-8-[3-(trifluoromethyl)anilino]octa-2,6-dienoxy]-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 123132263 |
| Molecular Formula | C17H21F3NO7P2-3 |
| Molecular Weight | 470.30 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | [[(2E,6E)-3,7-dimethyl-8-[3-(trifluoromethyl)anilino]octa-2,6-dienoxy]-oxidophosphoryl] phosphate |
| SMILES | C/C(=C\COP(=O)([O-])OP(=O)([O-])[O-])CC/C=C(\C)CNc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H24F3NO7P2/c1-13(9-10-27-30(25,26)28-29(22,23)24)5-3-6-14(2)12-21-16-8-4-7-15(11-16)17(18,19)20/h4,6-9,11,21H,3,5,10,12H2,1-2H3,(H,25,26)(H2,22,23,24)/p-3/b13-9+,14-6+ |
| InChIKey | JCPILLUXZWICJW-WSPXSRFVSA-K |
| XLogP | 3.12 |
| TPSA | 133.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|