C19H26N2O2 — CID 123132663
N-(1-hydroxy-3-methylbutan-2-yl)-2-(2-methylpropyl)quinoline-4-carboxamide (PubChem CID 123132663) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is N-(1-hydroxy-3-methylbutan-2-yl)-2-(2-methylpropyl)quinoline-4-carboxamide.
| Compound Name | N-(1-hydroxy-3-methylbutan-2-yl)-2-(2-methylpropyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 123132663 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | N-(1-hydroxy-3-methylbutan-2-yl)-2-(2-methylpropyl)quinoline-4-carboxamide |
| SMILES | CC(C)Cc1cc(C(=O)NC(CO)C(C)C)c2ccccc2n1 |
| InChI | InChI=1S/C19H26N2O2/c1-12(2)9-14-10-16(15-7-5-6-8-17(15)20-14)19(23)21-18(11-22)13(3)4/h5-8,10,12-13,18,22H,9,11H2,1-4H3,(H,21,23) |
| InChIKey | MAVZNMDSEBGBPB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |