C26H37N7 — CID 123133066
3-[6-(4-piperidin-4-ylpiperidin-1-yl)-2-pyridinyl]-5-pyridin-3-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrazolo[3,4-c]pyridine (PubChem CID 123133066) has the molecular formula C26H37N7 and a molecular weight of 447.63 g/mol. Its IUPAC name is 3-[6-(4-piperidin-4-ylpiperidin-1-yl)-2-pyridinyl]-5-pyridin-3-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrazolo[3,4-c]pyridine.
| Compound Name | 3-[6-(4-piperidin-4-ylpiperidin-1-yl)-2-pyridinyl]-5-pyridin-3-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrazolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 123133066 |
| Molecular Formula | C26H37N7 |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.31 |
| IUPAC Name | 3-[6-(4-piperidin-4-ylpiperidin-1-yl)-2-pyridinyl]-5-pyridin-3-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrazolo[3,4-c]pyridine |
| SMILES | c1cncc(C2CC3C(CN2)NNC3c2cccc(N3CCC(C4CCNCC4)CC3)n2)c1 |
| InChI | InChI=1S/C26H37N7/c1-4-22(26-21-15-23(20-3-2-10-28-16-20)29-17-24(21)31-32-26)30-25(5-1)33-13-8-19(9-14-33)18-6-11-27-12-7-18/h1-5,10,16,18-19,21,23-24,26-27,29,31-32H,6-9,11-15,17H2 |
| InChIKey | KWAYHVNYZLRZFJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |