About 5-[(1R)-2-[[(2R)-1-(3-aminophenyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,3-diol
5-[(1R)-2-[[(2R)-1-(3-aminophenyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,3-diol (PubChem CID 123133224) has the molecular formula C17H22N2O3
and a molecular weight of 302.37 g/mol. Its IUPAC name is 5-[(1R)-2-[[(2R)-1-(3-aminophenyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,3-diol.
Molecular Properties
| Compound Name | 5-[(1R)-2-[[(2R)-1-(3-aminophenyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,3-diol |
| PubChem CID | 123133224 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 5-[(1R)-2-[[(2R)-1-(3-aminophenyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,3-diol |
| SMILES | C[C@H](Cc1cccc(N)c1)NC[C@H](O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C17H22N2O3/c1-11(5-12-3-2-4-14(18)6-12)19-10-17(22)13-7-15(20)9-16(21)8-13/h2-4,6-9,11,17,19-22H,5,10,18H2,1H3/t11-,17+/m1/s1 |
| InChIKey | YSDUJIGQJOLYND-DIFFPNOSSA-N |
| XLogP | 1.93 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1R)-2-[[(2R)-1-(3-aminophenyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1R)-2-[[(2R)-1-(3-aminophenyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,3-diol?
The IUPAC name of 5-[(1R)-2-[[(2R)-1-(3-aminophenyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,3-diol (CID 123133224) is 5-[(1R)-2-[[(2R)-1-(3-aminophenyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,3-diol.
What is the SMILES notation for 5-[(1R)-2-[[(2R)-1-(3-aminophenyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,3-diol?
The canonical SMILES for 5-[(1R)-2-[[(2R)-1-(3-aminophenyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,3-diol is C[C@H](Cc1cccc(N)c1)NC[C@H](O)c1cc(O)cc(O)c1.
What is the InChIKey of 5-[(1R)-2-[[(2R)-1-(3-aminophenyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,3-diol?
The InChIKey is YSDUJIGQJOLYND-DIFFPNOSSA-N. The full InChI is InChI=1S/C17H22N2O3/c1-11(5-12-3-2-4-14(18)6-12)19-10-17(22)13-7-15(20)9-16(21)8-13/h2-4,6-9,11,17,19-22H,5,10,18H2,1H3/t11-,17+/m1/s1.
What are the key properties of 5-[(1R)-2-[[(2R)-1-(3-aminophenyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,3-diol?
5-[(1R)-2-[[(2R)-1-(3-aminophenyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,3-diol has a molecular weight of 302.37 g/mol, XLogP of 1.93, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1R)-2-[[(2R)-1-(3-aminophenyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,3-diol is sourced from PubChem (CID 123133224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).