C17H22N2O3 — CID 123133226
5-[(1S)-2-[[(2R)-1-(3-aminophenyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,3-diol (PubChem CID 123133226) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 5-[(1S)-2-[[(2R)-1-(3-aminophenyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,3-diol.
| Compound Name | 5-[(1S)-2-[[(2R)-1-(3-aminophenyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 123133226 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 5-[(1S)-2-[[(2R)-1-(3-aminophenyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,3-diol |
| SMILES | C[C@H](Cc1cccc(N)c1)NC[C@@H](O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C17H22N2O3/c1-11(5-12-3-2-4-14(18)6-12)19-10-17(22)13-7-15(20)9-16(21)8-13/h2-4,6-9,11,17,19-22H,5,10,18H2,1H3/t11-,17-/m1/s1 |
| InChIKey | YSDUJIGQJOLYND-PIGZYNQJSA-N |
| XLogP | 1.93 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|