C13H18O7S — CID 123133487
(2R,3S,4R,5S)-2,3,4,5-tetrahydroxy-6-(4-methylphenyl)sulfonylhexanal (PubChem CID 123133487) has the molecular formula C13H18O7S and a molecular weight of 318.35 g/mol. Its IUPAC name is (2R,3S,4R,5S)-2,3,4,5-tetrahydroxy-6-(4-methylphenyl)sulfonylhexanal.
| Compound Name | (2R,3S,4R,5S)-2,3,4,5-tetrahydroxy-6-(4-methylphenyl)sulfonylhexanal |
|---|---|
| PubChem CID | 123133487 |
| Molecular Formula | C13H18O7S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | (2R,3S,4R,5S)-2,3,4,5-tetrahydroxy-6-(4-methylphenyl)sulfonylhexanal |
| SMILES | Cc1ccc(S(=O)(=O)C[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C=O)cc1 |
| InChI | InChI=1S/C13H18O7S/c1-8-2-4-9(5-3-8)21(19,20)7-11(16)13(18)12(17)10(15)6-14/h2-6,10-13,15-18H,7H2,1H3/t10-,11+,12+,13-/m0/s1 |
| InChIKey | CEIQGXFNETWJNQ-LOWDOPEQSA-N |
| XLogP | -1.59 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|