C6H10O6 — CID 123133735
(3R,4R,5S,6R)-cyclohexene-1,2,3,4,5,6-hexol (PubChem CID 123133735) has the molecular formula C6H10O6 and a molecular weight of 178.14 g/mol. Its IUPAC name is (3R,4R,5S,6R)-cyclohexene-1,2,3,4,5,6-hexol.
| Compound Name | (3R,4R,5S,6R)-cyclohexene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 123133735 |
| Molecular Formula | C6H10O6 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | (3R,4R,5S,6R)-cyclohexene-1,2,3,4,5,6-hexol |
| SMILES | OC1=C(O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H10O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-4,7-12H/t1-,2+,3-,4-/m1/s1 |
| InChIKey | DMDAGHRAXPBBEL-GJPGBQJBSA-N |
| XLogP | -2.23 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |