About 4-[3-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)prop-2-ynyl]-5-methoxyphenyl]benzoic acid
4-[3-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)prop-2-ynyl]-5-methoxyphenyl]benzoic acid (PubChem CID 123133740) has the molecular formula C23H22N4O3
and a molecular weight of 402.45 g/mol. Its IUPAC name is 4-[3-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)prop-2-ynyl]-5-methoxyphenyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[3-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)prop-2-ynyl]-5-methoxyphenyl]benzoic acid |
| PubChem CID | 123133740 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 4-[3-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)prop-2-ynyl]-5-methoxyphenyl]benzoic acid |
| SMILES | CCc1nc(N)nc(N)c1C#CCc1cc(OC)cc(-c2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C23H22N4O3/c1-3-20-19(21(24)27-23(25)26-20)6-4-5-14-11-17(13-18(12-14)30-2)15-7-9-16(10-8-15)22(28)29/h7-13H,3,5H2,1-2H3,(H,28,29)(H4,24,25,26,27) |
| InChIKey | VLQRVOAJCWFFQG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 124.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)prop-2-ynyl]-5-methoxyphenyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)prop-2-ynyl]-5-methoxyphenyl]benzoic acid?
The IUPAC name of 4-[3-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)prop-2-ynyl]-5-methoxyphenyl]benzoic acid (CID 123133740) is 4-[3-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)prop-2-ynyl]-5-methoxyphenyl]benzoic acid.
What is the SMILES notation for 4-[3-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)prop-2-ynyl]-5-methoxyphenyl]benzoic acid?
The canonical SMILES for 4-[3-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)prop-2-ynyl]-5-methoxyphenyl]benzoic acid is CCc1nc(N)nc(N)c1C#CCc1cc(OC)cc(-c2ccc(C(=O)O)cc2)c1.
What is the InChIKey of 4-[3-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)prop-2-ynyl]-5-methoxyphenyl]benzoic acid?
The InChIKey is VLQRVOAJCWFFQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N4O3/c1-3-20-19(21(24)27-23(25)26-20)6-4-5-14-11-17(13-18(12-14)30-2)15-7-9-16(10-8-15)22(28)29/h7-13H,3,5H2,1-2H3,(H,28,29)(H4,24,25,26,27).
What are the key properties of 4-[3-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)prop-2-ynyl]-5-methoxyphenyl]benzoic acid?
4-[3-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)prop-2-ynyl]-5-methoxyphenyl]benzoic acid has a molecular weight of 402.45 g/mol, XLogP of 3.17, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[3-(2,4-diamino-6-ethylpyrimidin-5-yl)prop-2-ynyl]-5-methoxyphenyl]benzoic acid is sourced from PubChem (CID 123133740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).