About 3-fluoro-4-[4-(2-fluoro-4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol
3-fluoro-4-[4-(2-fluoro-4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol (PubChem CID 123133775) has the molecular formula C16H12F2O4S
and a molecular weight of 338.33 g/mol. Its IUPAC name is 3-fluoro-4-[4-(2-fluoro-4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol.
Molecular Properties
| Compound Name | 3-fluoro-4-[4-(2-fluoro-4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol |
| PubChem CID | 123133775 |
| Molecular Formula | C16H12F2O4S |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 3-fluoro-4-[4-(2-fluoro-4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol |
| SMILES | O=S1(=O)CC(c2ccc(O)cc2F)=C(c2ccc(O)cc2F)C1 |
| InChI | InChI=1S/C16H12F2O4S/c17-15-5-9(19)1-3-11(15)13-7-23(21,22)8-14(13)12-4-2-10(20)6-16(12)18/h1-6,19-20H,7-8H2 |
| InChIKey | RWLQJQSIVYIOMM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-4-[4-(2-fluoro-4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-[4-(2-fluoro-4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol?
The IUPAC name of 3-fluoro-4-[4-(2-fluoro-4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol (CID 123133775) is 3-fluoro-4-[4-(2-fluoro-4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol.
What is the SMILES notation for 3-fluoro-4-[4-(2-fluoro-4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol?
The canonical SMILES for 3-fluoro-4-[4-(2-fluoro-4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol is O=S1(=O)CC(c2ccc(O)cc2F)=C(c2ccc(O)cc2F)C1.
What is the InChIKey of 3-fluoro-4-[4-(2-fluoro-4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol?
The InChIKey is RWLQJQSIVYIOMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F2O4S/c17-15-5-9(19)1-3-11(15)13-7-23(21,22)8-14(13)12-4-2-10(20)6-16(12)18/h1-6,19-20H,7-8H2.
What are the key properties of 3-fluoro-4-[4-(2-fluoro-4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol?
3-fluoro-4-[4-(2-fluoro-4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol has a molecular weight of 338.33 g/mol, XLogP of 2.72, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-[4-(2-fluoro-4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol is sourced from PubChem (CID 123133775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).