C23H29N3O4 — CID 123133811
2,6-diacetamido-N-[4-[hydroxy(phenyl)methyl]phenyl]hexanamide (PubChem CID 123133811) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is 2,6-diacetamido-N-[4-[hydroxy(phenyl)methyl]phenyl]hexanamide.
| Compound Name | 2,6-diacetamido-N-[4-[hydroxy(phenyl)methyl]phenyl]hexanamide |
|---|---|
| PubChem CID | 123133811 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 2,6-diacetamido-N-[4-[hydroxy(phenyl)methyl]phenyl]hexanamide |
| SMILES | CC(=O)NCCCCC(NC(C)=O)C(=O)Nc1ccc(C(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H29N3O4/c1-16(27)24-15-7-6-10-21(25-17(2)28)23(30)26-20-13-11-19(12-14-20)22(29)18-8-4-3-5-9-18/h3-5,8-9,11-14,21-22,29H,6-7,10,15H2,1-2H3,(H,24,27)(H,25,28)(H,26,30) |
| InChIKey | LQPDYJDXYAJVNA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|