About CID 123134100
CID 123134100 (PubChem CID 123134100) has the molecular formula C28H38K2O2
and a molecular weight of 484.81 g/mol.
Molecular Properties
| Compound Name | CID 123134100 |
| PubChem CID | 123134100 |
| Molecular Formula | C28H38K2O2 |
| Molecular Weight | 484.81 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc2c(c(-c3c(O)c(C(C)(C)C)cc4c3CCCC4)c1O)CCCC2.[K].[K] |
| InChI | InChI=1S/C28H38O2.2K/c1-27(2,3)21-15-17-11-7-9-13-19(17)23(25(21)29)24-20-14-10-8-12-18(20)16-22(26(24)30)28(4,5)6;;/h15-16,29-30H,7-14H2,1-6H3;; |
| InChIKey | GZJXWZLMHZKQLF-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.81 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 123134100 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 123134100?
The IUPAC name of CID 123134100 (CID 123134100) is not available.
What is the SMILES notation for CID 123134100?
The canonical SMILES for CID 123134100 is CC(C)(C)c1cc2c(c(-c3c(O)c(C(C)(C)C)cc4c3CCCC4)c1O)CCCC2.[K].[K].
What is the InChIKey of CID 123134100?
The InChIKey is GZJXWZLMHZKQLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H38O2.2K/c1-27(2,3)21-15-17-11-7-9-13-19(17)23(25(21)29)24-20-14-10-8-12-18(20)16-22(26(24)30)28(4,5)6;;/h15-16,29-30H,7-14H2,1-6H3;;.
What are the key properties of CID 123134100?
CID 123134100 has a molecular weight of 484.81 g/mol, XLogP of 6.36, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 123134100 is sourced from PubChem (CID 123134100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).