C18H22ClI — CID 123134216
1-chloro-4-ethylbenzene;1-iodo-2,3,4,5-tetramethylbenzene (PubChem CID 123134216) has the molecular formula C18H22ClI and a molecular weight of 400.73 g/mol. Its IUPAC name is 1-chloro-4-ethylbenzene;1-iodo-2,3,4,5-tetramethylbenzene.
| Compound Name | 1-chloro-4-ethylbenzene;1-iodo-2,3,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 123134216 |
| Molecular Formula | C18H22ClI |
| Molecular Weight | 400.73 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 1-chloro-4-ethylbenzene;1-iodo-2,3,4,5-tetramethylbenzene |
| SMILES | CCc1ccc(Cl)cc1.Cc1cc(I)c(C)c(C)c1C |
| InChI | InChI=1S/C10H13I.C8H9Cl/c1-6-5-10(11)9(4)8(3)7(6)2;1-2-7-3-5-8(9)6-4-7/h5H,1-4H3;3-6H,2H2,1H3 |
| InChIKey | MWEFRNBOQLLPMS-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.73 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|