About 4-methoxy-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile
4-methoxy-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile (PubChem CID 123135127) has the molecular formula C9H7N3O
and a molecular weight of 173.17 g/mol. Its IUPAC name is 4-methoxy-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 4-methoxy-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile |
| PubChem CID | 123135127 |
| Molecular Formula | C9H7N3O |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 4-methoxy-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile |
| SMILES | COc1nccc2[nH]cc(C#N)c12 |
| InChI | InChI=1S/C9H7N3O/c1-13-9-8-6(4-10)5-12-7(8)2-3-11-9/h2-3,5,12H,1H3 |
| InChIKey | KSQJAHMDPPSLPT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 61.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxy-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile?
The IUPAC name of 4-methoxy-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile (CID 123135127) is 4-methoxy-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile.
What is the SMILES notation for 4-methoxy-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile?
The canonical SMILES for 4-methoxy-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile is COc1nccc2[nH]cc(C#N)c12.
What is the InChIKey of 4-methoxy-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile?
The InChIKey is KSQJAHMDPPSLPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O/c1-13-9-8-6(4-10)5-12-7(8)2-3-11-9/h2-3,5,12H,1H3.
What are the key properties of 4-methoxy-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile?
4-methoxy-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile has a molecular weight of 173.17 g/mol, XLogP of 1.44, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile is sourced from PubChem (CID 123135127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).