About 5-chloro-2-methyl-1H-pyrrolo[2,3-b]pyridin-6-amine
5-chloro-2-methyl-1H-pyrrolo[2,3-b]pyridin-6-amine (PubChem CID 123135474) has the molecular formula C8H8ClN3
and a molecular weight of 181.63 g/mol. Its IUPAC name is 5-chloro-2-methyl-1H-pyrrolo[2,3-b]pyridin-6-amine.
Molecular Properties
| Compound Name | 5-chloro-2-methyl-1H-pyrrolo[2,3-b]pyridin-6-amine |
| PubChem CID | 123135474 |
| Molecular Formula | C8H8ClN3 |
| Molecular Weight | 181.63 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 5-chloro-2-methyl-1H-pyrrolo[2,3-b]pyridin-6-amine |
| SMILES | Cc1cc2cc(Cl)c(N)nc2[nH]1 |
| InChI | InChI=1S/C8H8ClN3/c1-4-2-5-3-6(9)7(10)12-8(5)11-4/h2-3H,1H3,(H3,10,11,12) |
| InChIKey | CSFUEOGNGGPSNP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.63 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-2-methyl-1H-pyrrolo[2,3-b]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-methyl-1H-pyrrolo[2,3-b]pyridin-6-amine?
The IUPAC name of 5-chloro-2-methyl-1H-pyrrolo[2,3-b]pyridin-6-amine (CID 123135474) is 5-chloro-2-methyl-1H-pyrrolo[2,3-b]pyridin-6-amine.
What is the SMILES notation for 5-chloro-2-methyl-1H-pyrrolo[2,3-b]pyridin-6-amine?
The canonical SMILES for 5-chloro-2-methyl-1H-pyrrolo[2,3-b]pyridin-6-amine is Cc1cc2cc(Cl)c(N)nc2[nH]1.
What is the InChIKey of 5-chloro-2-methyl-1H-pyrrolo[2,3-b]pyridin-6-amine?
The InChIKey is CSFUEOGNGGPSNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN3/c1-4-2-5-3-6(9)7(10)12-8(5)11-4/h2-3H,1H3,(H3,10,11,12).
What are the key properties of 5-chloro-2-methyl-1H-pyrrolo[2,3-b]pyridin-6-amine?
5-chloro-2-methyl-1H-pyrrolo[2,3-b]pyridin-6-amine has a molecular weight of 181.63 g/mol, XLogP of 2.11, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-methyl-1H-pyrrolo[2,3-b]pyridin-6-amine is sourced from PubChem (CID 123135474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).