About 2-iodo-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile
2-iodo-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile (PubChem CID 123135618) has the molecular formula C8H4IN3
and a molecular weight of 269.05 g/mol. Its IUPAC name is 2-iodo-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile.
Molecular Properties
| Compound Name | 2-iodo-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile |
| PubChem CID | 123135618 |
| Molecular Formula | C8H4IN3 |
| Molecular Weight | 269.05 g/mol |
| Exact Mass | 268.94 |
| IUPAC Name | 2-iodo-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile |
| SMILES | N#Cc1ccnc2cc(I)[nH]c12 |
| InChI | InChI=1S/C8H4IN3/c9-7-3-6-8(12-7)5(4-10)1-2-11-6/h1-3,12H |
| InChIKey | OVGJAPZHLPAADV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.05 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile?
The IUPAC name of 2-iodo-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile (CID 123135618) is 2-iodo-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile.
What is the SMILES notation for 2-iodo-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile?
The canonical SMILES for 2-iodo-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile is N#Cc1ccnc2cc(I)[nH]c12.
What is the InChIKey of 2-iodo-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile?
The InChIKey is OVGJAPZHLPAADV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4IN3/c9-7-3-6-8(12-7)5(4-10)1-2-11-6/h1-3,12H.
What are the key properties of 2-iodo-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile?
2-iodo-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile has a molecular weight of 269.05 g/mol, XLogP of 2.04, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile is sourced from PubChem (CID 123135618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).