C8H4IN3 — CID 123135618
2-iodo-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile (PubChem CID 123135618) has the molecular formula C8H4IN3 and a molecular weight of 269.05 g/mol. Its IUPAC name is 2-iodo-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile.
| Compound Name | 2-iodo-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile |
|---|---|
| PubChem CID | 123135618 |
| Molecular Formula | C8H4IN3 |
| Molecular Weight | 269.05 g/mol |
| Exact Mass | 268.94 |
| IUPAC Name | 2-iodo-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile |
| SMILES | N#Cc1ccnc2cc(I)[nH]c12 |
| InChI | InChI=1S/C8H4IN3/c9-7-3-6-8(12-7)5(4-10)1-2-11-6/h1-3,12H |
| InChIKey | OVGJAPZHLPAADV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.05 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|