C26H42N2O5 — CID 123135984
2-hydroxy-2-[(3S,14R,17S,18R)-3,20,20-trimethyl-2,16-dioxo-21-oxa-1-azatricyclo[15.6.0.018,22]tricos-8-en-14-yl]acetamide (PubChem CID 123135984) has the molecular formula C26H42N2O5 and a molecular weight of 462.63 g/mol. Its IUPAC name is 2-hydroxy-2-[(3S,14R,17S,18R)-3,20,20-trimethyl-2,16-dioxo-21-oxa-1-azatricyclo[15.6.0.018,22]tricos-8-en-14-yl]acetamide.
| Compound Name | 2-hydroxy-2-[(3S,14R,17S,18R)-3,20,20-trimethyl-2,16-dioxo-21-oxa-1-azatricyclo[15.6.0.018,22]tricos-8-en-14-yl]acetamide |
|---|---|
| PubChem CID | 123135984 |
| Molecular Formula | C26H42N2O5 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.31 |
| IUPAC Name | 2-hydroxy-2-[(3S,14R,17S,18R)-3,20,20-trimethyl-2,16-dioxo-21-oxa-1-azatricyclo[15.6.0.018,22]tricos-8-en-14-yl]acetamide |
| SMILES | C[C@H]1CCCCC=CCCCC[C@@H](C(O)C(N)=O)CC(=O)[C@@H]2[C@H]3CC(C)(C)OC3CN2C1=O |
| InChI | InChI=1S/C26H42N2O5/c1-17-12-10-8-6-4-5-7-9-11-13-18(23(30)24(27)31)14-20(29)22-19-15-26(2,3)33-21(19)16-28(22)25(17)32/h4-5,17-19,21-23,30H,6-16H2,1-3H3,(H2,27,31)/t17-,18+,19-,21?,22-,23?/m0/s1 |
| InChIKey | PFGBPGRBTAAMMO-AUZGCIRMSA-N |
| XLogP | 3.13 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|