About 3-benzyl-1-[4-(1,3-diiminopropan-2-yl)-3-methoxyphenyl]pyrrolidin-2-one
3-benzyl-1-[4-(1,3-diiminopropan-2-yl)-3-methoxyphenyl]pyrrolidin-2-one (PubChem CID 123136288) has the molecular formula C21H23N3O2
and a molecular weight of 349.43 g/mol. Its IUPAC name is 3-benzyl-1-[4-(1,3-diiminopropan-2-yl)-3-methoxyphenyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 3-benzyl-1-[4-(1,3-diiminopropan-2-yl)-3-methoxyphenyl]pyrrolidin-2-one |
| PubChem CID | 123136288 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 3-benzyl-1-[4-(1,3-diiminopropan-2-yl)-3-methoxyphenyl]pyrrolidin-2-one |
| SMILES | [H]/N=C/C(/C=N/[H])c1ccc(N2CCC(Cc3ccccc3)C2=O)cc1OC |
| InChI | InChI=1S/C21H23N3O2/c1-26-20-12-18(7-8-19(20)17(13-22)14-23)24-10-9-16(21(24)25)11-15-5-3-2-4-6-15/h2-8,12-14,16-17,22-23H,9-11H2,1H3/b22-13+,23-14+ |
| InChIKey | FCDUSHGKOBPRHP-MSKUYSOUSA-N |
| XLogP | 3.67 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-1-[4-(1,3-diiminopropan-2-yl)-3-methoxyphenyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-1-[4-(1,3-diiminopropan-2-yl)-3-methoxyphenyl]pyrrolidin-2-one?
The IUPAC name of 3-benzyl-1-[4-(1,3-diiminopropan-2-yl)-3-methoxyphenyl]pyrrolidin-2-one (CID 123136288) is 3-benzyl-1-[4-(1,3-diiminopropan-2-yl)-3-methoxyphenyl]pyrrolidin-2-one.
What is the SMILES notation for 3-benzyl-1-[4-(1,3-diiminopropan-2-yl)-3-methoxyphenyl]pyrrolidin-2-one?
The canonical SMILES for 3-benzyl-1-[4-(1,3-diiminopropan-2-yl)-3-methoxyphenyl]pyrrolidin-2-one is [H]/N=C/C(/C=N/[H])c1ccc(N2CCC(Cc3ccccc3)C2=O)cc1OC.
What is the InChIKey of 3-benzyl-1-[4-(1,3-diiminopropan-2-yl)-3-methoxyphenyl]pyrrolidin-2-one?
The InChIKey is FCDUSHGKOBPRHP-MSKUYSOUSA-N. The full InChI is InChI=1S/C21H23N3O2/c1-26-20-12-18(7-8-19(20)17(13-22)14-23)24-10-9-16(21(24)25)11-15-5-3-2-4-6-15/h2-8,12-14,16-17,22-23H,9-11H2,1H3/b22-13+,23-14+.
What are the key properties of 3-benzyl-1-[4-(1,3-diiminopropan-2-yl)-3-methoxyphenyl]pyrrolidin-2-one?
3-benzyl-1-[4-(1,3-diiminopropan-2-yl)-3-methoxyphenyl]pyrrolidin-2-one has a molecular weight of 349.43 g/mol, XLogP of 3.67, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-1-[4-(1,3-diiminopropan-2-yl)-3-methoxyphenyl]pyrrolidin-2-one is sourced from PubChem (CID 123136288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).