C12H7Cl2F9 — CID 123136322
1,3-bis(chloromethyl)-5-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)benzene (PubChem CID 123136322) has the molecular formula C12H7Cl2F9 and a molecular weight of 393.08 g/mol. Its IUPAC name is 1,3-bis(chloromethyl)-5-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)benzene.
| Compound Name | 1,3-bis(chloromethyl)-5-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)benzene |
|---|---|
| PubChem CID | 123136322 |
| Molecular Formula | C12H7Cl2F9 |
| Molecular Weight | 393.08 g/mol |
| Exact Mass | 391.98 |
| IUPAC Name | 1,3-bis(chloromethyl)-5-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)benzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(c1cc(CCl)cc(CCl)c1)C(F)(F)F |
| InChI | InChI=1S/C12H7Cl2F9/c13-4-6-1-7(5-14)3-8(2-6)9(15,11(18,19)20)10(16,17)12(21,22)23/h1-3H,4-5H2 |
| InChIKey | IWXQKUPQHNQCSP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.08 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|