C10H5F11O4 — CID 123136380
(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl) 2-acetyloxyacetate (PubChem CID 123136380) has the molecular formula C10H5F11O4 and a molecular weight of 398.12 g/mol. Its IUPAC name is (1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl) 2-acetyloxyacetate.
| Compound Name | (1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl) 2-acetyloxyacetate |
|---|---|
| PubChem CID | 123136380 |
| Molecular Formula | C10H5F11O4 |
| Molecular Weight | 398.12 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | (1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl) 2-acetyloxyacetate |
| SMILES | CC(=O)OCC(=O)OC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H5F11O4/c1-3(22)24-2-4(23)25-10(21)8(17,18)6(13,14)5(11,12)7(15,16)9(10,19)20/h2H2,1H3 |
| InChIKey | DEYNHQNHFPRJTP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.12 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|