About (3E)-1-[5-chloro-4-(3,5-dimethyl-2-pyridinyl)-2-pyridinyl]-3-hydrazinylidenepiperidin-4-one
(3E)-1-[5-chloro-4-(3,5-dimethyl-2-pyridinyl)-2-pyridinyl]-3-hydrazinylidenepiperidin-4-one (PubChem CID 123136538) has the molecular formula C17H18ClN5O
and a molecular weight of 343.82 g/mol. Its IUPAC name is (3E)-1-[5-chloro-4-(3,5-dimethyl-2-pyridinyl)-2-pyridinyl]-3-hydrazinylidenepiperidin-4-one.
Molecular Properties
| Compound Name | (3E)-1-[5-chloro-4-(3,5-dimethyl-2-pyridinyl)-2-pyridinyl]-3-hydrazinylidenepiperidin-4-one |
| PubChem CID | 123136538 |
| Molecular Formula | C17H18ClN5O |
| Molecular Weight | 343.82 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | (3E)-1-[5-chloro-4-(3,5-dimethyl-2-pyridinyl)-2-pyridinyl]-3-hydrazinylidenepiperidin-4-one |
| SMILES | Cc1cnc(-c2cc(N3CCC(=O)/C(=N/N)C3)ncc2Cl)c(C)c1 |
| InChI | InChI=1S/C17H18ClN5O/c1-10-5-11(2)17(21-7-10)12-6-16(20-8-13(12)18)23-4-3-15(24)14(9-23)22-19/h5-8H,3-4,9,19H2,1-2H3/b22-14+ |
| InChIKey | VTUVKRSOTXPERG-HYARGMPZSA-N |
| XLogP | 2.51 |
| TPSA | 84.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.82 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3E)-1-[5-chloro-4-(3,5-dimethyl-2-pyridinyl)-2-pyridinyl]-3-hydrazinylidenepiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-1-[5-chloro-4-(3,5-dimethyl-2-pyridinyl)-2-pyridinyl]-3-hydrazinylidenepiperidin-4-one?
The IUPAC name of (3E)-1-[5-chloro-4-(3,5-dimethyl-2-pyridinyl)-2-pyridinyl]-3-hydrazinylidenepiperidin-4-one (CID 123136538) is (3E)-1-[5-chloro-4-(3,5-dimethyl-2-pyridinyl)-2-pyridinyl]-3-hydrazinylidenepiperidin-4-one.
What is the SMILES notation for (3E)-1-[5-chloro-4-(3,5-dimethyl-2-pyridinyl)-2-pyridinyl]-3-hydrazinylidenepiperidin-4-one?
The canonical SMILES for (3E)-1-[5-chloro-4-(3,5-dimethyl-2-pyridinyl)-2-pyridinyl]-3-hydrazinylidenepiperidin-4-one is Cc1cnc(-c2cc(N3CCC(=O)/C(=N/N)C3)ncc2Cl)c(C)c1.
What is the InChIKey of (3E)-1-[5-chloro-4-(3,5-dimethyl-2-pyridinyl)-2-pyridinyl]-3-hydrazinylidenepiperidin-4-one?
The InChIKey is VTUVKRSOTXPERG-HYARGMPZSA-N. The full InChI is InChI=1S/C17H18ClN5O/c1-10-5-11(2)17(21-7-10)12-6-16(20-8-13(12)18)23-4-3-15(24)14(9-23)22-19/h5-8H,3-4,9,19H2,1-2H3/b22-14+.
What are the key properties of (3E)-1-[5-chloro-4-(3,5-dimethyl-2-pyridinyl)-2-pyridinyl]-3-hydrazinylidenepiperidin-4-one?
(3E)-1-[5-chloro-4-(3,5-dimethyl-2-pyridinyl)-2-pyridinyl]-3-hydrazinylidenepiperidin-4-one has a molecular weight of 343.82 g/mol, XLogP of 2.51, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-1-[5-chloro-4-(3,5-dimethyl-2-pyridinyl)-2-pyridinyl]-3-hydrazinylidenepiperidin-4-one is sourced from PubChem (CID 123136538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).