C36H50F3N5O6 — CID 123137144
N-[3-[1-[4-(2-ethyl-1,5,7,9,11,13-hexamethyl-6,12,16-trioxo-3,17-dioxa-15-azabicyclo[12.3.0]heptadecan-15-yl)butyl]triazol-4-yl]phenyl]-2,2,2-trifluoroacetamide (PubChem CID 123137144) has the molecular formula C36H50F3N5O6 and a molecular weight of 705.82 g/mol. Its IUPAC name is N-[3-[1-[4-(2-ethyl-1,5,7,9,11,13-hexamethyl-6,12,16-trioxo-3,17-dioxa-15-azabicyclo[12.3.0]heptadecan-15-yl)butyl]triazol-4-yl]phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[1-[4-(2-ethyl-1,5,7,9,11,13-hexamethyl-6,12,16-trioxo-3,17-dioxa-15-azabicyclo[12.3.0]heptadecan-15-yl)butyl]triazol-4-yl]phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 123137144 |
| Molecular Formula | C36H50F3N5O6 |
| Molecular Weight | 705.82 g/mol |
| Exact Mass | 705.37 |
| IUPAC Name | N-[3-[1-[4-(2-ethyl-1,5,7,9,11,13-hexamethyl-6,12,16-trioxo-3,17-dioxa-15-azabicyclo[12.3.0]heptadecan-15-yl)butyl]triazol-4-yl]phenyl]-2,2,2-trifluoroacetamide |
| SMILES | CCC1OCC(C)C(=O)C(C)CC(C)CC(C)C(=O)C(C)C2N(CCCCn3cc(-c4cccc(NC(=O)C(F)(F)F)c4)nn3)C(=O)OC12C |
| InChI | InChI=1S/C36H50F3N5O6/c1-8-29-35(7)32(25(6)31(46)23(4)17-21(2)16-22(3)30(45)24(5)20-49-29)44(34(48)50-35)15-10-9-14-43-19-28(41-42-43)26-12-11-13-27(18-26)40-33(47)36(37,38)39/h11-13,18-19,21-25,29,32H,8-10,14-17,20H2,1-7H3,(H,40,47) |
| InChIKey | NDNSAJHISRPBEP-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 132.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.82 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|