C20H42O — CID 123137487
8-ethoxy-2,2,3,4,4,5,5,6,6-nonamethylnonane (PubChem CID 123137487) has the molecular formula C20H42O and a molecular weight of 298.56 g/mol. Its IUPAC name is 8-ethoxy-2,2,3,4,4,5,5,6,6-nonamethylnonane.
| Compound Name | 8-ethoxy-2,2,3,4,4,5,5,6,6-nonamethylnonane |
|---|---|
| PubChem CID | 123137487 |
| Molecular Formula | C20H42O |
| Molecular Weight | 298.56 g/mol |
| Exact Mass | 298.32 |
| IUPAC Name | 8-ethoxy-2,2,3,4,4,5,5,6,6-nonamethylnonane |
| SMILES | CCOC(C)CC(C)(C)C(C)(C)C(C)(C)C(C)C(C)(C)C |
| InChI | InChI=1S/C20H42O/c1-13-21-15(2)14-18(7,8)20(11,12)19(9,10)16(3)17(4,5)6/h15-16H,13-14H2,1-12H3 |
| InChIKey | SSDQNUJIJOWYAK-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.56 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |