C19H15ClF3NO3 — CID 123137994
2-[1-[4-chloro-3-(trifluoromethyl)phenyl]-2-methylpropan-2-yl]-4-hydroxyisoindole-1,3-dione (PubChem CID 123137994) has the molecular formula C19H15ClF3NO3 and a molecular weight of 397.78 g/mol. Its IUPAC name is 2-[1-[4-chloro-3-(trifluoromethyl)phenyl]-2-methylpropan-2-yl]-4-hydroxyisoindole-1,3-dione.
| Compound Name | 2-[1-[4-chloro-3-(trifluoromethyl)phenyl]-2-methylpropan-2-yl]-4-hydroxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 123137994 |
| Molecular Formula | C19H15ClF3NO3 |
| Molecular Weight | 397.78 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 2-[1-[4-chloro-3-(trifluoromethyl)phenyl]-2-methylpropan-2-yl]-4-hydroxyisoindole-1,3-dione |
| SMILES | CC(C)(Cc1ccc(Cl)c(C(F)(F)F)c1)N1C(=O)c2cccc(O)c2C1=O |
| InChI | InChI=1S/C19H15ClF3NO3/c1-18(2,9-10-6-7-13(20)12(8-10)19(21,22)23)24-16(26)11-4-3-5-14(25)15(11)17(24)27/h3-8,25H,9H2,1-2H3 |
| InChIKey | WEAMBOVBIANOAD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.78 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|