C29H36N2O4 — CID 123138508
tert-butyl (1R,10R,14S)-12-oxo-14-phenylspiro[16-oxa-13-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-triene-8,3'-azetidine]-1'-carboxylate;ethane (PubChem CID 123138508) has the molecular formula C29H36N2O4 and a molecular weight of 476.62 g/mol. Its IUPAC name is tert-butyl (1R,10R,14S)-12-oxo-14-phenylspiro[16-oxa-13-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-triene-8,3'-azetidine]-1'-carboxylate;ethane.
| Compound Name | tert-butyl (1R,10R,14S)-12-oxo-14-phenylspiro[16-oxa-13-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-triene-8,3'-azetidine]-1'-carboxylate;ethane |
|---|---|
| PubChem CID | 123138508 |
| Molecular Formula | C29H36N2O4 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | tert-butyl (1R,10R,14S)-12-oxo-14-phenylspiro[16-oxa-13-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-triene-8,3'-azetidine]-1'-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CC2(C[C@@H]3CC(=O)N4[C@@H](c5ccccc5)CO[C@@]34c3ccccc32)C1 |
| InChI | InChI=1S/C27H30N2O4.C2H6/c1-25(2,3)33-24(31)28-16-26(17-28)14-19-13-23(30)29-22(18-9-5-4-6-10-18)15-32-27(19,29)21-12-8-7-11-20(21)26;1-2/h4-12,19,22H,13-17H2,1-3H3;1-2H3/t19-,22+,27+;/m0./s1 |
| InChIKey | OEZPEKAVXJPGAO-NYAHSNDCSA-N |
| XLogP | 5.38 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |