C22H31BO3P2 — CID 123138537
(3aR,4R,5R,6aS)-4-[(3S)-4,4-dimethyl-3-(2-phenylethyl)pent-1-enyl]-5-(2-oxoboranyldiphosphanyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 123138537) has the molecular formula C22H31BO3P2 and a molecular weight of 416.25 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(3S)-4,4-dimethyl-3-(2-phenylethyl)pent-1-enyl]-5-(2-oxoboranyldiphosphanyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-4-[(3S)-4,4-dimethyl-3-(2-phenylethyl)pent-1-enyl]-5-(2-oxoboranyldiphosphanyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 123138537 |
| Molecular Formula | C22H31BO3P2 |
| Molecular Weight | 416.25 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(3S)-4,4-dimethyl-3-(2-phenylethyl)pent-1-enyl]-5-(2-oxoboranyldiphosphanyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CC(C)(C)[C@H](C=C[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1PPB=O)CCc1ccccc1 |
| InChI | InChI=1S/C22H31BO3P2/c1-22(2,3)16(10-9-15-7-5-4-6-8-15)11-12-17-18-13-21(24)26-19(18)14-20(17)27-28-23-25/h4-8,11-12,16-20,27-28H,9-10,13-14H2,1-3H3/t16-,17+,18+,19-,20+/m0/s1 |
| InChIKey | SEORJUDYUDAJCP-MFKWGIFDSA-N |
| XLogP | 5.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.25 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|