C27H45NO6Si — CID 123138894
[(3R,4aR,5S,10S,10aS,10bS)-10-tert-butyl-10-dimethylsilyloxy-3-ethenyl-10b-hydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-2,5,8,9-tetrahydrobenzo[f]chromen-5-yl] carbamate (PubChem CID 123138894) has the molecular formula C27H45NO6Si and a molecular weight of 507.74 g/mol. Its IUPAC name is [(3R,4aR,5S,10S,10aS,10bS)-10-tert-butyl-10-dimethylsilyloxy-3-ethenyl-10b-hydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-2,5,8,9-tetrahydrobenzo[f]chromen-5-yl] carbamate.
| Compound Name | [(3R,4aR,5S,10S,10aS,10bS)-10-tert-butyl-10-dimethylsilyloxy-3-ethenyl-10b-hydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-2,5,8,9-tetrahydrobenzo[f]chromen-5-yl] carbamate |
|---|---|
| PubChem CID | 123138894 |
| Molecular Formula | C27H45NO6Si |
| Molecular Weight | 507.74 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | [(3R,4aR,5S,10S,10aS,10bS)-10-tert-butyl-10-dimethylsilyloxy-3-ethenyl-10b-hydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-2,5,8,9-tetrahydrobenzo[f]chromen-5-yl] carbamate |
| SMILES | C=C[C@@]1(C)CC(=O)[C@]2(O)[C@]3(C)C(=C[C@H](OC(N)=O)[C@@]2(C)O1)C(C)(C)CC[C@]3(O[SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C27H45NO6Si/c1-12-23(7)16-18(29)27(31)24(8)17(15-19(32-20(28)30)25(27,9)33-23)22(5,6)13-14-26(24,21(2,3)4)34-35(10)11/h12,15,19,31,35H,1,13-14,16H2,2-11H3,(H2,28,30)/t19-,23-,24+,25+,26-,27-/m0/s1 |
| InChIKey | IRPBDEGXKDIONO-BMDBOLHWSA-N |
| XLogP | 4.43 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.74 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|