About 5-(3-fluoro-4-propylphenyl)-1,3,2-dioxathiane 2-oxide
5-(3-fluoro-4-propylphenyl)-1,3,2-dioxathiane 2-oxide (PubChem CID 123138913) has the molecular formula C12H15FO3S
and a molecular weight of 258.31 g/mol. Its IUPAC name is 5-(3-fluoro-4-propylphenyl)-1,3,2-dioxathiane 2-oxide.
Molecular Properties
| Compound Name | 5-(3-fluoro-4-propylphenyl)-1,3,2-dioxathiane 2-oxide |
| PubChem CID | 123138913 |
| Molecular Formula | C12H15FO3S |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 5-(3-fluoro-4-propylphenyl)-1,3,2-dioxathiane 2-oxide |
| SMILES | CCCc1ccc(C2COS(=O)OC2)cc1F |
| InChI | InChI=1S/C12H15FO3S/c1-2-3-9-4-5-10(6-12(9)13)11-7-15-17(14)16-8-11/h4-6,11H,2-3,7-8H2,1H3 |
| InChIKey | OPPJCIDYTDAILB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3-fluoro-4-propylphenyl)-1,3,2-dioxathiane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-fluoro-4-propylphenyl)-1,3,2-dioxathiane 2-oxide?
The IUPAC name of 5-(3-fluoro-4-propylphenyl)-1,3,2-dioxathiane 2-oxide (CID 123138913) is 5-(3-fluoro-4-propylphenyl)-1,3,2-dioxathiane 2-oxide.
What is the SMILES notation for 5-(3-fluoro-4-propylphenyl)-1,3,2-dioxathiane 2-oxide?
The canonical SMILES for 5-(3-fluoro-4-propylphenyl)-1,3,2-dioxathiane 2-oxide is CCCc1ccc(C2COS(=O)OC2)cc1F.
What is the InChIKey of 5-(3-fluoro-4-propylphenyl)-1,3,2-dioxathiane 2-oxide?
The InChIKey is OPPJCIDYTDAILB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FO3S/c1-2-3-9-4-5-10(6-12(9)13)11-7-15-17(14)16-8-11/h4-6,11H,2-3,7-8H2,1H3.
What are the key properties of 5-(3-fluoro-4-propylphenyl)-1,3,2-dioxathiane 2-oxide?
5-(3-fluoro-4-propylphenyl)-1,3,2-dioxathiane 2-oxide has a molecular weight of 258.31 g/mol, XLogP of 2.49, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-fluoro-4-propylphenyl)-1,3,2-dioxathiane 2-oxide is sourced from PubChem (CID 123138913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).