C24H25N3O3S — CID 123138953
5-(1H-indol-5-ylsulfonyl)-7-methoxy-9-methyl-9,14-diazatetracyclo[10.2.2.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraene (PubChem CID 123138953) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is 5-(1H-indol-5-ylsulfonyl)-7-methoxy-9-methyl-9,14-diazatetracyclo[10.2.2.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraene.
| Compound Name | 5-(1H-indol-5-ylsulfonyl)-7-methoxy-9-methyl-9,14-diazatetracyclo[10.2.2.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraene |
|---|---|
| PubChem CID | 123138953 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 5-(1H-indol-5-ylsulfonyl)-7-methoxy-9-methyl-9,14-diazatetracyclo[10.2.2.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraene |
| SMILES | COc1cc(S(=O)(=O)c2ccc3[nH]ccc3c2)cc2c3c(n(C)c12)CC1CCC3NC1 |
| InChI | InChI=1S/C24H25N3O3S/c1-27-21-9-14-3-5-20(26-13-14)23(21)18-11-17(12-22(30-2)24(18)27)31(28,29)16-4-6-19-15(10-16)7-8-25-19/h4,6-8,10-12,14,20,25-26H,3,5,9,13H2,1-2H3 |
| InChIKey | UVTDRIBMKSVWRO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|