C15H32N2OS — CID 123139180
N-(4-amino-2,4-dimethylpentan-2-yl)-2,2,4-trimethyl-4-sulfanylpentanamide (PubChem CID 123139180) has the molecular formula C15H32N2OS and a molecular weight of 288.50 g/mol. Its IUPAC name is N-(4-amino-2,4-dimethylpentan-2-yl)-2,2,4-trimethyl-4-sulfanylpentanamide.
| Compound Name | N-(4-amino-2,4-dimethylpentan-2-yl)-2,2,4-trimethyl-4-sulfanylpentanamide |
|---|---|
| PubChem CID | 123139180 |
| Molecular Formula | C15H32N2OS |
| Molecular Weight | 288.50 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | N-(4-amino-2,4-dimethylpentan-2-yl)-2,2,4-trimethyl-4-sulfanylpentanamide |
| SMILES | CC(C)(N)CC(C)(C)NC(=O)C(C)(C)CC(C)(C)S |
| InChI | InChI=1S/C15H32N2OS/c1-12(2,9-15(7,8)19)11(18)17-14(5,6)10-13(3,4)16/h19H,9-10,16H2,1-8H3,(H,17,18) |
| InChIKey | ZHOBWITZSHZMGU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|