C11H21NO — CID 123139486
N-but-2-en-2-yl-N,2,2-trimethylbutanamide (PubChem CID 123139486) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is N-but-2-en-2-yl-N,2,2-trimethylbutanamide.
| Compound Name | N-but-2-en-2-yl-N,2,2-trimethylbutanamide |
|---|---|
| PubChem CID | 123139486 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | N-but-2-en-2-yl-N,2,2-trimethylbutanamide |
| SMILES | CC=C(C)N(C)C(=O)C(C)(C)CC |
| InChI | InChI=1S/C11H21NO/c1-7-9(3)12(6)10(13)11(4,5)8-2/h7H,8H2,1-6H3 |
| InChIKey | KJMNLMRCYZJTNI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |