C6H5ClF2O2S — CID 123139507
2,6-difluorocyclohexa-1,3-diene-1-sulfonyl chloride (PubChem CID 123139507) has the molecular formula C6H5ClF2O2S and a molecular weight of 214.62 g/mol. Its IUPAC name is 2,6-difluorocyclohexa-1,3-diene-1-sulfonyl chloride.
| Compound Name | 2,6-difluorocyclohexa-1,3-diene-1-sulfonyl chloride |
|---|---|
| PubChem CID | 123139507 |
| Molecular Formula | C6H5ClF2O2S |
| Molecular Weight | 214.62 g/mol |
| Exact Mass | 213.97 |
| IUPAC Name | 2,6-difluorocyclohexa-1,3-diene-1-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)C1=C(F)C=CCC1F |
| InChI | InChI=1S/C6H5ClF2O2S/c7-12(10,11)6-4(8)2-1-3-5(6)9/h1-2,5H,3H2 |
| InChIKey | CHFVBBFGXWAVOF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.62 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |