C10H9NS4 — CID 123139988
10-amino-4,9-dimethyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-5-thiol (PubChem CID 123139988) has the molecular formula C10H9NS4 and a molecular weight of 271.46 g/mol. Its IUPAC name is 10-amino-4,9-dimethyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-5-thiol.
| Compound Name | 10-amino-4,9-dimethyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-5-thiol |
|---|---|
| PubChem CID | 123139988 |
| Molecular Formula | C10H9NS4 |
| Molecular Weight | 271.46 g/mol |
| Exact Mass | 270.96 |
| IUPAC Name | 10-amino-4,9-dimethyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-5-thiol |
| SMILES | Cc1sc2c(sc3c(C)c(N)sc32)c1S |
| InChI | InChI=1S/C10H9NS4/c1-3-6-8(15-10(3)11)9-7(14-6)5(12)4(2)13-9/h12H,11H2,1-2H3 |
| InChIKey | RVRIERCJNWXJDP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|