About N'-methanimidoyl-2,4-dimethylpenta-2,4-dienimidamide
N'-methanimidoyl-2,4-dimethylpenta-2,4-dienimidamide (PubChem CID 123140467) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is N'-methanimidoyl-2,4-dimethylpenta-2,4-dienimidamide.
Molecular Properties
| Compound Name | N'-methanimidoyl-2,4-dimethylpenta-2,4-dienimidamide |
| PubChem CID | 123140467 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | N'-methanimidoyl-2,4-dimethylpenta-2,4-dienimidamide |
| SMILES | [H]/N=C/N=C(\N)C(C)=CC(=C)C |
| InChI | InChI=1S/C8H13N3/c1-6(2)4-7(3)8(10)11-5-9/h4-5H,1H2,2-3H3,(H3,9,10,11) |
| InChIKey | NAKNXEDAWJRTQN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-methanimidoyl-2,4-dimethylpenta-2,4-dienimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methanimidoyl-2,4-dimethylpenta-2,4-dienimidamide?
The IUPAC name of N'-methanimidoyl-2,4-dimethylpenta-2,4-dienimidamide (CID 123140467) is N'-methanimidoyl-2,4-dimethylpenta-2,4-dienimidamide.
What is the SMILES notation for N'-methanimidoyl-2,4-dimethylpenta-2,4-dienimidamide?
The canonical SMILES for N'-methanimidoyl-2,4-dimethylpenta-2,4-dienimidamide is [H]/N=C/N=C(\N)C(C)=CC(=C)C.
What is the InChIKey of N'-methanimidoyl-2,4-dimethylpenta-2,4-dienimidamide?
The InChIKey is NAKNXEDAWJRTQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-6(2)4-7(3)8(10)11-5-9/h4-5H,1H2,2-3H3,(H3,9,10,11).
What are the key properties of N'-methanimidoyl-2,4-dimethylpenta-2,4-dienimidamide?
N'-methanimidoyl-2,4-dimethylpenta-2,4-dienimidamide has a molecular weight of 151.21 g/mol, XLogP of 1.47, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methanimidoyl-2,4-dimethylpenta-2,4-dienimidamide is sourced from PubChem (CID 123140467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).