C30H47N3O3Si2 — CID 123140551
3-[6-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-ylamino]-3-pyridinyl]-5-methyl-2H-isoquinolin-1-one (PubChem CID 123140551) has the molecular formula C30H47N3O3Si2 and a molecular weight of 553.90 g/mol. Its IUPAC name is 3-[6-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-ylamino]-3-pyridinyl]-5-methyl-2H-isoquinolin-1-one.
| Compound Name | 3-[6-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-ylamino]-3-pyridinyl]-5-methyl-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 123140551 |
| Molecular Formula | C30H47N3O3Si2 |
| Molecular Weight | 553.90 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | 3-[6-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-ylamino]-3-pyridinyl]-5-methyl-2H-isoquinolin-1-one |
| SMILES | Cc1cccc2c(=O)[nH]c(-c3ccc(NC(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)nc3)cc12 |
| InChI | InChI=1S/C30H47N3O3Si2/c1-21-13-12-14-24-25(21)17-26(33-28(24)34)22-15-16-27(31-18-22)32-23(19-35-37(8,9)29(2,3)4)20-36-38(10,11)30(5,6)7/h12-18,23H,19-20H2,1-11H3,(H,31,32)(H,33,34) |
| InChIKey | KDMBXJAZYYBAAQ-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.90 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|