C21H33N7O — CID 123140713
(2R)-2-amino-N-[4-[[8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]cyclohexyl]-4-methylpentanamide (PubChem CID 123140713) has the molecular formula C21H33N7O and a molecular weight of 399.54 g/mol. Its IUPAC name is (2R)-2-amino-N-[4-[[8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]cyclohexyl]-4-methylpentanamide.
| Compound Name | (2R)-2-amino-N-[4-[[8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]cyclohexyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 123140713 |
| Molecular Formula | C21H33N7O |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | (2R)-2-amino-N-[4-[[8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]cyclohexyl]-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](N)C(=O)NC1CCC(Nc2cc(NC3CC3)c3nccn3n2)CC1 |
| InChI | InChI=1S/C21H33N7O/c1-13(2)11-17(22)21(29)26-16-7-5-15(6-8-16)25-19-12-18(24-14-3-4-14)20-23-9-10-28(20)27-19/h9-10,12-17,24H,3-8,11,22H2,1-2H3,(H,25,27)(H,26,29)/t15?,16?,17-/m1/s1 |
| InChIKey | SURZNWSRABCUHB-OFLPRAFFSA-N |
| XLogP | 2.52 |
| TPSA | 109.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|