C13H26N2 — CID 123140737
N'-(3,7-dimethylocta-2,6-dienyl)propane-1,3-diamine (PubChem CID 123140737) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is N'-(3,7-dimethylocta-2,6-dienyl)propane-1,3-diamine.
| Compound Name | N'-(3,7-dimethylocta-2,6-dienyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 123140737 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | N'-(3,7-dimethylocta-2,6-dienyl)propane-1,3-diamine |
| SMILES | CC(C)=CCCC(C)=CCNCCCN |
| InChI | InChI=1S/C13H26N2/c1-12(2)6-4-7-13(3)8-11-15-10-5-9-14/h6,8,15H,4-5,7,9-11,14H2,1-3H3 |
| InChIKey | QQLYOKNVUBMTBS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|