About 3-(3,5-dimethoxyphenyl)-7-(3-methylpiperazin-1-yl)chromen-2-one
3-(3,5-dimethoxyphenyl)-7-(3-methylpiperazin-1-yl)chromen-2-one (PubChem CID 123141054) has the molecular formula C22H24N2O4
and a molecular weight of 380.44 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-7-(3-methylpiperazin-1-yl)chromen-2-one.
Molecular Properties
| Compound Name | 3-(3,5-dimethoxyphenyl)-7-(3-methylpiperazin-1-yl)chromen-2-one |
| PubChem CID | 123141054 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-7-(3-methylpiperazin-1-yl)chromen-2-one |
| SMILES | COc1cc(OC)cc(-c2cc3ccc(N4CCNC(C)C4)cc3oc2=O)c1 |
| InChI | InChI=1S/C22H24N2O4/c1-14-13-24(7-6-23-14)17-5-4-15-10-20(22(25)28-21(15)11-17)16-8-18(26-2)12-19(9-16)27-3/h4-5,8-12,14,23H,6-7,13H2,1-3H3 |
| InChIKey | JRBBKNQXUYZDQC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-dimethoxyphenyl)-7-(3-methylpiperazin-1-yl)chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethoxyphenyl)-7-(3-methylpiperazin-1-yl)chromen-2-one?
The IUPAC name of 3-(3,5-dimethoxyphenyl)-7-(3-methylpiperazin-1-yl)chromen-2-one (CID 123141054) is 3-(3,5-dimethoxyphenyl)-7-(3-methylpiperazin-1-yl)chromen-2-one.
What is the SMILES notation for 3-(3,5-dimethoxyphenyl)-7-(3-methylpiperazin-1-yl)chromen-2-one?
The canonical SMILES for 3-(3,5-dimethoxyphenyl)-7-(3-methylpiperazin-1-yl)chromen-2-one is COc1cc(OC)cc(-c2cc3ccc(N4CCNC(C)C4)cc3oc2=O)c1.
What is the InChIKey of 3-(3,5-dimethoxyphenyl)-7-(3-methylpiperazin-1-yl)chromen-2-one?
The InChIKey is JRBBKNQXUYZDQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O4/c1-14-13-24(7-6-23-14)17-5-4-15-10-20(22(25)28-21(15)11-17)16-8-18(26-2)12-19(9-16)27-3/h4-5,8-12,14,23H,6-7,13H2,1-3H3.
What are the key properties of 3-(3,5-dimethoxyphenyl)-7-(3-methylpiperazin-1-yl)chromen-2-one?
3-(3,5-dimethoxyphenyl)-7-(3-methylpiperazin-1-yl)chromen-2-one has a molecular weight of 380.44 g/mol, XLogP of 3.28, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethoxyphenyl)-7-(3-methylpiperazin-1-yl)chromen-2-one is sourced from PubChem (CID 123141054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).