About 2-(4-fluorophenyl)-N,5,5-trimethyl-4-methylidenefuran-3-carboxamide
2-(4-fluorophenyl)-N,5,5-trimethyl-4-methylidenefuran-3-carboxamide (PubChem CID 123141372) has the molecular formula C15H16FNO2
and a molecular weight of 261.30 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N,5,5-trimethyl-4-methylidenefuran-3-carboxamide.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-N,5,5-trimethyl-4-methylidenefuran-3-carboxamide |
| PubChem CID | 123141372 |
| Molecular Formula | C15H16FNO2 |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2-(4-fluorophenyl)-N,5,5-trimethyl-4-methylidenefuran-3-carboxamide |
| SMILES | C=C1C(C(=O)NC)=C(c2ccc(F)cc2)OC1(C)C |
| InChI | InChI=1S/C15H16FNO2/c1-9-12(14(18)17-4)13(19-15(9,2)3)10-5-7-11(16)8-6-10/h5-8H,1H2,2-4H3,(H,17,18) |
| InChIKey | MVZNDRWWSUXMGZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-fluorophenyl)-N,5,5-trimethyl-4-methylidenefuran-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-N,5,5-trimethyl-4-methylidenefuran-3-carboxamide?
The IUPAC name of 2-(4-fluorophenyl)-N,5,5-trimethyl-4-methylidenefuran-3-carboxamide (CID 123141372) is 2-(4-fluorophenyl)-N,5,5-trimethyl-4-methylidenefuran-3-carboxamide.
What is the SMILES notation for 2-(4-fluorophenyl)-N,5,5-trimethyl-4-methylidenefuran-3-carboxamide?
The canonical SMILES for 2-(4-fluorophenyl)-N,5,5-trimethyl-4-methylidenefuran-3-carboxamide is C=C1C(C(=O)NC)=C(c2ccc(F)cc2)OC1(C)C.
What is the InChIKey of 2-(4-fluorophenyl)-N,5,5-trimethyl-4-methylidenefuran-3-carboxamide?
The InChIKey is MVZNDRWWSUXMGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16FNO2/c1-9-12(14(18)17-4)13(19-15(9,2)3)10-5-7-11(16)8-6-10/h5-8H,1H2,2-4H3,(H,17,18).
What are the key properties of 2-(4-fluorophenyl)-N,5,5-trimethyl-4-methylidenefuran-3-carboxamide?
2-(4-fluorophenyl)-N,5,5-trimethyl-4-methylidenefuran-3-carboxamide has a molecular weight of 261.30 g/mol, XLogP of 2.65, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-N,5,5-trimethyl-4-methylidenefuran-3-carboxamide is sourced from PubChem (CID 123141372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).