C32H46F5NO3SSi — CID 123141961
tert-butyl-[7,7-dimethyl-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-dimethylsilane (PubChem CID 123141961) has the molecular formula C32H46F5NO3SSi and a molecular weight of 647.87 g/mol. Its IUPAC name is tert-butyl-[7,7-dimethyl-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[7,7-dimethyl-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 123141961 |
| Molecular Formula | C32H46F5NO3SSi |
| Molecular Weight | 647.87 g/mol |
| Exact Mass | 647.29 |
| IUPAC Name | tert-butyl-[7,7-dimethyl-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-dimethylsilane |
| SMILES | CC(C)c1nc2c(c3c1C(c1ccc(S(F)(F)(F)(F)F)cc1)OC31CCOCC1)C(O[Si](C)(C)C(C)(C)C)CC(C)(C)C2 |
| InChI | InChI=1S/C32H46F5NO3SSi/c1-20(2)28-26-27(25-23(38-28)18-31(6,7)19-24(25)41-43(8,9)30(3,4)5)32(14-16-39-17-15-32)40-29(26)21-10-12-22(13-11-21)42(33,34,35,36)37/h10-13,20,24,29H,14-19H2,1-9H3 |
| InChIKey | CFGVSBKVGWLBIS-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.87 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|