C20H18F3N5O4S — CID 123142029
N-[2-(2-hydroxyethoxy)ethyl]-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]-3H-benzimidazole-5-carboxamide (PubChem CID 123142029) has the molecular formula C20H18F3N5O4S and a molecular weight of 481.46 g/mol. Its IUPAC name is N-[2-(2-hydroxyethoxy)ethyl]-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[2-(2-hydroxyethoxy)ethyl]-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 123142029 |
| Molecular Formula | C20H18F3N5O4S |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | N-[2-(2-hydroxyethoxy)ethyl]-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(NCCOCCO)c1ccc2nc(Nc3nc4ccc(OC(F)(F)F)cc4s3)[nH]c2c1 |
| InChI | InChI=1S/C20H18F3N5O4S/c21-20(22,23)32-12-2-4-14-16(10-12)33-19(27-14)28-18-25-13-3-1-11(9-15(13)26-18)17(30)24-5-7-31-8-6-29/h1-4,9-10,29H,5-8H2,(H,24,30)(H2,25,26,27,28) |
| InChIKey | IYNFDJNADLJYQF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 121.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|