C21H40N+ — CID 123142037
1,2,2,3-tetramethyl-1-[2-(4,4,5,6-tetramethylheptyl)-1-bicyclo[1.1.0]butanyl]aziridin-1-ium (PubChem CID 123142037) has the molecular formula C21H40N+ and a molecular weight of 306.56 g/mol. Its IUPAC name is 1,2,2,3-tetramethyl-1-[2-(4,4,5,6-tetramethylheptyl)-1-bicyclo[1.1.0]butanyl]aziridin-1-ium.
| Compound Name | 1,2,2,3-tetramethyl-1-[2-(4,4,5,6-tetramethylheptyl)-1-bicyclo[1.1.0]butanyl]aziridin-1-ium |
|---|---|
| PubChem CID | 123142037 |
| Molecular Formula | C21H40N+ |
| Molecular Weight | 306.56 g/mol |
| Exact Mass | 306.32 |
| IUPAC Name | 1,2,2,3-tetramethyl-1-[2-(4,4,5,6-tetramethylheptyl)-1-bicyclo[1.1.0]butanyl]aziridin-1-ium |
| SMILES | CC(C)C(C)C(C)(C)CCCC1C2CC12[N+]1(C)C(C)C1(C)C |
| InChI | InChI=1S/C21H40N/c1-14(2)15(3)19(5,6)12-10-11-17-18-13-21(17,18)22(9)16(4)20(22,7)8/h14-18H,10-13H2,1-9H3/q+1 |
| InChIKey | FTUFTYCRSCOBTQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.56 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|